C21H40O7Si — CID 11539292
methyl (4R,5S)-5-[(1R,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-triethylsilyloxypropan-2-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 11539292) has the molecular formula C21H40O7Si and a molecular weight of 432.63 g/mol. Its IUPAC name is methyl (4R,5S)-5-[(1R,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-triethylsilyloxypropan-2-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl (4R,5S)-5-[(1R,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-triethylsilyloxypropan-2-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 11539292 |
| Molecular Formula | C21H40O7Si |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | methyl (4R,5S)-5-[(1R,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-triethylsilyloxypropan-2-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | CC[Si](CC)(CC)O[C@H]([C@@H](C)[C@@H]1OC(C)(C)O[C@H]1C(=O)OC)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C21H40O7Si/c1-10-29(11-2,12-3)28-16(15-13-24-20(5,6)25-15)14(4)17-18(19(22)23-9)27-21(7,8)26-17/h14-18H,10-13H2,1-9H3/t14-,15+,16-,17+,18-/m1/s1 |
| InChIKey | VXUAAOXDAGQWIH-MDMSPXHWSA-N |
| XLogP | 3.86 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|