C21H42O7Si — CID 134971266
methyl (2R,3S,4S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-4-methyl-3-propan-2-yloxy-5-triethylsilyloxypentanoate (PubChem CID 134971266) has the molecular formula C21H42O7Si and a molecular weight of 434.65 g/mol. Its IUPAC name is methyl (2R,3S,4S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-4-methyl-3-propan-2-yloxy-5-triethylsilyloxypentanoate.
| Compound Name | methyl (2R,3S,4S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-4-methyl-3-propan-2-yloxy-5-triethylsilyloxypentanoate |
|---|---|
| PubChem CID | 134971266 |
| Molecular Formula | C21H42O7Si |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | methyl (2R,3S,4S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-4-methyl-3-propan-2-yloxy-5-triethylsilyloxypentanoate |
| SMILES | CC[Si](CC)(CC)O[C@H]([C@@H](C)[C@H](OC(C)C)[C@@H](O)C(=O)OC)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C21H42O7Si/c1-10-29(11-2,12-3)28-18(16-13-25-21(7,8)27-16)15(6)19(26-14(4)5)17(22)20(23)24-9/h14-19,22H,10-13H2,1-9H3/t15-,16+,17-,18-,19+/m1/s1 |
| InChIKey | QTBHRTSCSAEGBH-ZRSRNVLSSA-N |
| XLogP | 3.49 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|