C17H32O5Si — CID 135014806
ethyl (E,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-triethylsilyloxybut-2-enoate (PubChem CID 135014806) has the molecular formula C17H32O5Si and a molecular weight of 344.52 g/mol. Its IUPAC name is ethyl (E,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-triethylsilyloxybut-2-enoate.
| Compound Name | ethyl (E,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-triethylsilyloxybut-2-enoate |
|---|---|
| PubChem CID | 135014806 |
| Molecular Formula | C17H32O5Si |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | ethyl (E,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-triethylsilyloxybut-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](O[Si](CC)(CC)CC)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C17H32O5Si/c1-7-19-16(18)12-11-14(15-13-20-17(5,6)21-15)22-23(8-2,9-3)10-4/h11-12,14-15H,7-10,13H2,1-6H3/b12-11+/t14-,15+/m0/s1 |
| InChIKey | OLIGIJHQLUVULC-AMXOMPAFSA-N |
| XLogP | 3.65 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|