C22H44O7Si — CID 135012656
methyl (2R,3S,4S,5R)-3-butan-2-yloxy-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-4-methyl-5-triethylsilyloxypentanoate (PubChem CID 135012656) has the molecular formula C22H44O7Si and a molecular weight of 448.67 g/mol. Its IUPAC name is methyl (2R,3S,4S,5R)-3-butan-2-yloxy-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-4-methyl-5-triethylsilyloxypentanoate.
| Compound Name | methyl (2R,3S,4S,5R)-3-butan-2-yloxy-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-4-methyl-5-triethylsilyloxypentanoate |
|---|---|
| PubChem CID | 135012656 |
| Molecular Formula | C22H44O7Si |
| Molecular Weight | 448.67 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | methyl (2R,3S,4S,5R)-3-butan-2-yloxy-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-4-methyl-5-triethylsilyloxypentanoate |
| SMILES | CCC(C)O[C@@H]([C@H](C)[C@@H](O[Si](CC)(CC)CC)[C@@H]1COC(C)(C)O1)[C@@H](O)C(=O)OC |
| InChI | InChI=1S/C22H44O7Si/c1-10-15(5)27-20(18(23)21(24)25-9)16(6)19(17-14-26-22(7,8)28-17)29-30(11-2,12-3)13-4/h15-20,23H,10-14H2,1-9H3/t15?,16-,17+,18-,19-,20+/m1/s1 |
| InChIKey | VCIMXIVKMQKZLM-CKBJSLFLSA-N |
| XLogP | 3.88 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.67 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|