C19H36O8Si — CID 155932020
dimethyl (5R)-4-hydroxy-2,2-dimethyl-5-(3-triethylsilyloxybutyl)-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 155932020) has the molecular formula C19H36O8Si and a molecular weight of 420.58 g/mol. Its IUPAC name is dimethyl (5R)-4-hydroxy-2,2-dimethyl-5-(3-triethylsilyloxybutyl)-1,3-dioxolane-4,5-dicarboxylate.
| Compound Name | dimethyl (5R)-4-hydroxy-2,2-dimethyl-5-(3-triethylsilyloxybutyl)-1,3-dioxolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 155932020 |
| Molecular Formula | C19H36O8Si |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | dimethyl (5R)-4-hydroxy-2,2-dimethyl-5-(3-triethylsilyloxybutyl)-1,3-dioxolane-4,5-dicarboxylate |
| SMILES | CC[Si](CC)(CC)OC(C)CC[C@@]1(C(=O)OC)OC(C)(C)OC1(O)C(=O)OC |
| InChI | InChI=1S/C19H36O8Si/c1-9-28(10-2,11-3)25-14(4)12-13-18(15(20)23-7)19(22,16(21)24-8)27-17(5,6)26-18/h14,22H,9-13H2,1-8H3/t14?,18-,19?/m0/s1 |
| InChIKey | HZLQECHXPAQDCC-WHDUELSGSA-N |
| XLogP | 2.73 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|