C20H34O10Si — CID 155931201
trimethyl 2-[tert-butyl(dimethyl)silyl]oxy-5-(2-hydroxyethyl)-6,8-dioxabicyclo[3.2.1]octane-1,2,7-tricarboxylate (PubChem CID 155931201) has the molecular formula C20H34O10Si and a molecular weight of 462.57 g/mol. Its IUPAC name is trimethyl 2-[tert-butyl(dimethyl)silyl]oxy-5-(2-hydroxyethyl)-6,8-dioxabicyclo[3.2.1]octane-1,2,7-tricarboxylate.
| Compound Name | trimethyl 2-[tert-butyl(dimethyl)silyl]oxy-5-(2-hydroxyethyl)-6,8-dioxabicyclo[3.2.1]octane-1,2,7-tricarboxylate |
|---|---|
| PubChem CID | 155931201 |
| Molecular Formula | C20H34O10Si |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | trimethyl 2-[tert-butyl(dimethyl)silyl]oxy-5-(2-hydroxyethyl)-6,8-dioxabicyclo[3.2.1]octane-1,2,7-tricarboxylate |
| SMILES | COC(=O)C1OC2(CCO)CCC(O[Si](C)(C)C(C)(C)C)(C(=O)OC)C1(C(=O)OC)O2 |
| InChI | InChI=1S/C20H34O10Si/c1-17(2,3)31(7,8)30-19(15(23)26-5)10-9-18(11-12-21)28-13(14(22)25-4)20(19,29-18)16(24)27-6/h13,21H,9-12H2,1-8H3 |
| InChIKey | HPWSGDINXGTDDX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|