C14H20O10 — CID 155931772
trimethyl 2-hydroxy-5-(2-hydroxyethyl)-6,8-dioxabicyclo[3.2.1]octane-1,2,7-tricarboxylate (PubChem CID 155931772) has the molecular formula C14H20O10 and a molecular weight of 348.30 g/mol. Its IUPAC name is trimethyl 2-hydroxy-5-(2-hydroxyethyl)-6,8-dioxabicyclo[3.2.1]octane-1,2,7-tricarboxylate.
| Compound Name | trimethyl 2-hydroxy-5-(2-hydroxyethyl)-6,8-dioxabicyclo[3.2.1]octane-1,2,7-tricarboxylate |
|---|---|
| PubChem CID | 155931772 |
| Molecular Formula | C14H20O10 |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | trimethyl 2-hydroxy-5-(2-hydroxyethyl)-6,8-dioxabicyclo[3.2.1]octane-1,2,7-tricarboxylate |
| SMILES | COC(=O)C1OC2(CCO)CCC(O)(C(=O)OC)C1(C(=O)OC)O2 |
| InChI | InChI=1S/C14H20O10/c1-20-9(16)8-14(11(18)22-3)13(19,10(17)21-2)5-4-12(23-8,24-14)6-7-15/h8,15,19H,4-7H2,1-3H3 |
| InChIKey | WYOSSGPKDGYECR-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|