C14H19IO9 — CID 155931199
trimethyl 4-hydroxy-1-(2-iodoethyl)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate (PubChem CID 155931199) has the molecular formula C14H19IO9 and a molecular weight of 458.20 g/mol. Its IUPAC name is trimethyl 4-hydroxy-1-(2-iodoethyl)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate.
| Compound Name | trimethyl 4-hydroxy-1-(2-iodoethyl)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 155931199 |
| Molecular Formula | C14H19IO9 |
| Molecular Weight | 458.20 g/mol |
| Exact Mass | 458.01 |
| IUPAC Name | trimethyl 4-hydroxy-1-(2-iodoethyl)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate |
| SMILES | COC(=O)C1OC2(CCI)CCC(C(=O)OC)(O2)C1(O)C(=O)OC |
| InChI | InChI=1S/C14H19IO9/c1-20-9(16)8-14(19,11(18)22-3)13(10(17)21-2)5-4-12(23-8,24-13)6-7-15/h8,19H,4-7H2,1-3H3 |
| InChIKey | CEMOVLGMUXYMMI-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.20 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|