C13H18O9 — CID 72815871
trimethyl 4-hydroxy-1-methyl-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate (PubChem CID 72815871) has the molecular formula C13H18O9 and a molecular weight of 318.28 g/mol. Its IUPAC name is trimethyl 4-hydroxy-1-methyl-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate.
| Compound Name | trimethyl 4-hydroxy-1-methyl-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 72815871 |
| Molecular Formula | C13H18O9 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | trimethyl 4-hydroxy-1-methyl-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate |
| SMILES | COC(=O)C1OC2(C)CCC(C(=O)OC)(O2)C1(O)C(=O)OC |
| InChI | InChI=1S/C13H18O9/c1-11-5-6-12(22-11,9(15)19-3)13(17,10(16)20-4)7(21-11)8(14)18-2/h7,17H,5-6H2,1-4H3 |
| InChIKey | DYRAZAYNDVCYJL-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|