C24H44O7Si — CID 10600525
(3aR,4R,7aR)-4-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]methyl]-2,2-diethyl-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-one (PubChem CID 10600525) has the molecular formula C24H44O7Si and a molecular weight of 472.70 g/mol. Its IUPAC name is (3aR,4R,7aR)-4-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]methyl]-2,2-diethyl-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-one.
| Compound Name | (3aR,4R,7aR)-4-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]methyl]-2,2-diethyl-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-one |
|---|---|
| PubChem CID | 10600525 |
| Molecular Formula | C24H44O7Si |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | (3aR,4R,7aR)-4-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]methyl]-2,2-diethyl-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-one |
| SMILES | CCC1(CC)OC[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2OCC(=O)[C@@H]3OC(CC)(CC)O[C@H]23)O1 |
| InChI | InChI=1S/C24H44O7Si/c1-10-23(11-2)27-15-17(28-23)19(31-32(8,9)22(5,6)7)20-21-18(16(25)14-26-20)29-24(12-3,13-4)30-21/h17-21H,10-15H2,1-9H3/t17-,18+,19+,20+,21+/m1/s1 |
| InChIKey | YOHUKWVPZFCFPT-SYAJIYQZSA-N |
| XLogP | 4.58 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|