C26H44O7Si — CID 164674990
(2S,3R)-3-[(2S,3S)-3-[(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-triethylsilyloxymethyl]-1,4-dioxaspiro[4.5]decan-2-yl]oxirane-2-carbaldehyde (PubChem CID 164674990) has the molecular formula C26H44O7Si and a molecular weight of 496.72 g/mol. Its IUPAC name is (2S,3R)-3-[(2S,3S)-3-[(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-triethylsilyloxymethyl]-1,4-dioxaspiro[4.5]decan-2-yl]oxirane-2-carbaldehyde.
| Compound Name | (2S,3R)-3-[(2S,3S)-3-[(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-triethylsilyloxymethyl]-1,4-dioxaspiro[4.5]decan-2-yl]oxirane-2-carbaldehyde |
|---|---|
| PubChem CID | 164674990 |
| Molecular Formula | C26H44O7Si |
| Molecular Weight | 496.72 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | (2S,3R)-3-[(2S,3S)-3-[(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-triethylsilyloxymethyl]-1,4-dioxaspiro[4.5]decan-2-yl]oxirane-2-carbaldehyde |
| SMILES | CC[Si](CC)(CC)O[C@H]([C@H]1OC2(CCCCC2)O[C@H]1[C@H]1O[C@@H]1C=O)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C26H44O7Si/c1-4-34(5-2,6-3)33-22(20-18-28-25(30-20)13-9-7-10-14-25)24-23(21-19(17-27)29-21)31-26(32-24)15-11-8-12-16-26/h17,19-24H,4-16,18H2,1-3H3/t19-,20-,21+,22+,23+,24-/m1/s1 |
| InChIKey | KNABMHKRETYUFT-PEOLYXCJSA-N |
| XLogP | 4.86 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.72 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|