C26H52O7Si2 — CID 11060501
(3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanal (PubChem CID 11060501) has the molecular formula C26H52O7Si2 and a molecular weight of 532.87 g/mol. Its IUPAC name is (3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanal.
| Compound Name | (3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanal |
|---|---|
| PubChem CID | 11060501 |
| Molecular Formula | C26H52O7Si2 |
| Molecular Weight | 532.87 g/mol |
| Exact Mass | 532.33 |
| IUPAC Name | (3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanal |
| SMILES | CC1(C)O[C@H]([C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CC=O)O[Si](C)(C)C(C)(C)C)[C@@H]([C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C26H52O7Si2/c1-23(2,3)34(11,12)32-18(15-16-27)21(33-35(13,14)24(4,5)6)22-20(30-26(9,10)31-22)19-17-28-25(7,8)29-19/h16,18-22H,15,17H2,1-14H3/t18-,19+,20+,21-,22-/m0/s1 |
| InChIKey | HEKLQSSOMIWEGL-MNVIUDHYSA-N |
| XLogP | 6.03 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.87 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|