C17H30O5Si — CID 139262762
(1S,4S,6R,8S,9R)-8-[tert-butyl(dimethyl)silyl]oxy-11,11-dimethyl-5,10,12-trioxatricyclo[7.3.0.04,6]dodecan-2-one (PubChem CID 139262762) has the molecular formula C17H30O5Si and a molecular weight of 342.51 g/mol. Its IUPAC name is (1S,4S,6R,8S,9R)-8-[tert-butyl(dimethyl)silyl]oxy-11,11-dimethyl-5,10,12-trioxatricyclo[7.3.0.04,6]dodecan-2-one.
| Compound Name | (1S,4S,6R,8S,9R)-8-[tert-butyl(dimethyl)silyl]oxy-11,11-dimethyl-5,10,12-trioxatricyclo[7.3.0.04,6]dodecan-2-one |
|---|---|
| PubChem CID | 139262762 |
| Molecular Formula | C17H30O5Si |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (1S,4S,6R,8S,9R)-8-[tert-butyl(dimethyl)silyl]oxy-11,11-dimethyl-5,10,12-trioxatricyclo[7.3.0.04,6]dodecan-2-one |
| SMILES | CC1(C)O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]3O[C@H]3CC(=O)[C@H]2O1 |
| InChI | InChI=1S/C17H30O5Si/c1-16(2,3)23(6,7)22-13-9-12-11(19-12)8-10(18)14-15(13)21-17(4,5)20-14/h11-15H,8-9H2,1-7H3/t11-,12+,13-,14+,15-/m0/s1 |
| InChIKey | MJLCCPHZNJOIFX-ZQNQSHIBSA-N |
| XLogP | 3.03 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|