C18H34O6Si — CID 11047004
2-[(3aR,4S,6R,6aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxy-2,2,6-trimethyl-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-4-yl]acetaldehyde (PubChem CID 11047004) has the molecular formula C18H34O6Si and a molecular weight of 374.55 g/mol. Its IUPAC name is 2-[(3aR,4S,6R,6aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxy-2,2,6-trimethyl-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-4-yl]acetaldehyde.
| Compound Name | 2-[(3aR,4S,6R,6aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxy-2,2,6-trimethyl-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 11047004 |
| Molecular Formula | C18H34O6Si |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 2-[(3aR,4S,6R,6aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxy-2,2,6-trimethyl-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-4-yl]acetaldehyde |
| SMILES | CO[C@@]1(CC=O)O[C@](C)(CO[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C18H34O6Si/c1-15(2,3)25(8,9)21-12-17(6)13-14(23-16(4,5)22-13)18(20-7,24-17)10-11-19/h11,13-14H,10,12H2,1-9H3/t13-,14+,17+,18-/m0/s1 |
| InChIKey | BDNHIRJCQSBPGU-JFTQMJAMSA-N |
| XLogP | 3.25 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|