C22H40O6Si — CID 11407727
(3aS,5S,6aR)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-5,6a-diethyl-3,6-dihydrofuro[3,2-b]furan-2-one (PubChem CID 11407727) has the molecular formula C22H40O6Si and a molecular weight of 428.64 g/mol. Its IUPAC name is (3aS,5S,6aR)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-5,6a-diethyl-3,6-dihydrofuro[3,2-b]furan-2-one.
| Compound Name | (3aS,5S,6aR)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-5,6a-diethyl-3,6-dihydrofuro[3,2-b]furan-2-one |
|---|---|
| PubChem CID | 11407727 |
| Molecular Formula | C22H40O6Si |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | (3aS,5S,6aR)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-5,6a-diethyl-3,6-dihydrofuro[3,2-b]furan-2-one |
| SMILES | CC[C@@]1(C2COC(C)(C)O2)C[C@@]2(CC)OC(=O)C[C@@]2(CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C22H40O6Si/c1-10-20(16-13-24-19(6,7)26-16)14-21(11-2)22(28-20,12-17(23)27-21)15-25-29(8,9)18(3,4)5/h16H,10-15H2,1-9H3/t16?,20-,21+,22-/m0/s1 |
| InChIKey | VCKURCNTHQQSRU-PODFZXOASA-N |
| XLogP | 4.56 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|