C22H40O8Si — CID 10994192
methyl 2-[(3aS,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4-trimethylsilyloxy-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]-2-ethylbutanoate (PubChem CID 10994192) has the molecular formula C22H40O8Si and a molecular weight of 460.64 g/mol. Its IUPAC name is methyl 2-[(3aS,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4-trimethylsilyloxy-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]-2-ethylbutanoate.
| Compound Name | methyl 2-[(3aS,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4-trimethylsilyloxy-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]-2-ethylbutanoate |
|---|---|
| PubChem CID | 10994192 |
| Molecular Formula | C22H40O8Si |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | methyl 2-[(3aS,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4-trimethylsilyloxy-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]-2-ethylbutanoate |
| SMILES | CCC(CC)(C(=O)OC)C1(O[Si](C)(C)C)O[C@H]([C@H]2COC(C)(C)O2)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C22H40O8Si/c1-11-21(12-2,18(23)24-7)22(30-31(8,9)10)17-16(27-20(5,6)29-17)15(28-22)14-13-25-19(3,4)26-14/h14-17H,11-13H2,1-10H3/t14-,15-,16+,17+,22?/m1/s1 |
| InChIKey | KANRMZXDRUJXKI-UEJAKOHDSA-N |
| XLogP | 3.58 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|