C18H32O6Si — CID 155934539
(3R,3aR,6aR)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6a-[(2-methyl-1,3-dioxolan-2-yl)methyl]-2,3,3a,4-tetrahydrofuro[2,3-b]furan-5-one (PubChem CID 155934539) has the molecular formula C18H32O6Si and a molecular weight of 372.53 g/mol. Its IUPAC name is (3R,3aR,6aR)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6a-[(2-methyl-1,3-dioxolan-2-yl)methyl]-2,3,3a,4-tetrahydrofuro[2,3-b]furan-5-one.
| Compound Name | (3R,3aR,6aR)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6a-[(2-methyl-1,3-dioxolan-2-yl)methyl]-2,3,3a,4-tetrahydrofuro[2,3-b]furan-5-one |
|---|---|
| PubChem CID | 155934539 |
| Molecular Formula | C18H32O6Si |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (3R,3aR,6aR)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6a-[(2-methyl-1,3-dioxolan-2-yl)methyl]-2,3,3a,4-tetrahydrofuro[2,3-b]furan-5-one |
| SMILES | CC1(C[C@]23OC[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]2CC(=O)O3)OCCO1 |
| InChI | InChI=1S/C18H32O6Si/c1-16(2,3)25(5,6)23-11-13-10-22-18(14(13)9-15(19)24-18)12-17(4)20-7-8-21-17/h13-14H,7-12H2,1-6H3/t13-,14-,18-/m1/s1 |
| InChIKey | VJYJWUKTKRCRMW-HBUWYVDXSA-N |
| XLogP | 3.07 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|