C23H42O7Si — CID 10884992
(3aR,5S,6R,6aR)-6-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carbaldehyde (PubChem CID 10884992) has the molecular formula C23H42O7Si and a molecular weight of 458.67 g/mol. Its IUPAC name is (3aR,5S,6R,6aR)-6-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carbaldehyde.
| Compound Name | (3aR,5S,6R,6aR)-6-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carbaldehyde |
|---|---|
| PubChem CID | 10884992 |
| Molecular Formula | C23H42O7Si |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | (3aR,5S,6R,6aR)-6-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carbaldehyde |
| SMILES | CC1(C)OC[C@H]([C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@@]2(C=O)CCCCO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C23H42O7Si/c1-20(2,3)31(8,9)26-13-11-10-12-23(15-24)17(16-14-25-21(4,5)28-16)27-19-18(23)29-22(6,7)30-19/h15-19H,10-14H2,1-9H3/t16-,17-,18+,19-,23-/m1/s1 |
| InChIKey | GEMSTWKEYKLXQQ-BYXWFHEMSA-N |
| XLogP | 4.39 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|