C23H44O6Si2 — CID 10983580
(1R,2R,3R,7R,8S,9S)-2,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5-dimethyl-4,6,10-trioxatricyclo[7.2.1.03,7]dodecan-11-one (PubChem CID 10983580) has the molecular formula C23H44O6Si2 and a molecular weight of 472.77 g/mol. Its IUPAC name is (1R,2R,3R,7R,8S,9S)-2,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5-dimethyl-4,6,10-trioxatricyclo[7.2.1.03,7]dodecan-11-one.
| Compound Name | (1R,2R,3R,7R,8S,9S)-2,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5-dimethyl-4,6,10-trioxatricyclo[7.2.1.03,7]dodecan-11-one |
|---|---|
| PubChem CID | 10983580 |
| Molecular Formula | C23H44O6Si2 |
| Molecular Weight | 472.77 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | (1R,2R,3R,7R,8S,9S)-2,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5-dimethyl-4,6,10-trioxatricyclo[7.2.1.03,7]dodecan-11-one |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C[C@H](OC1=O)[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O6Si2/c1-21(2,3)30(9,10)28-16-14-13-15(25-20(14)24)17(29-31(11,12)22(4,5)6)19-18(16)26-23(7,8)27-19/h14-19H,13H2,1-12H3/t14-,15+,16-,17+,18+,19+/m1/s1 |
| InChIKey | HHSYRHHANYOKRU-SGYMCOKNSA-N |
| XLogP | 5.23 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.77 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|