C21H40O6Si — CID 10811853
ethyl (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dimethyl-3-oxohexanoate (PubChem CID 10811853) has the molecular formula C21H40O6Si and a molecular weight of 416.63 g/mol. Its IUPAC name is ethyl (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dimethyl-3-oxohexanoate.
| Compound Name | ethyl (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dimethyl-3-oxohexanoate |
|---|---|
| PubChem CID | 10811853 |
| Molecular Formula | C21H40O6Si |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | ethyl (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dimethyl-3-oxohexanoate |
| SMILES | CCOC(=O)C(C)C(=O)[C@H](C)[C@@H](C[C@H]1COC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O6Si/c1-11-24-19(23)15(3)18(22)14(2)17(27-28(9,10)20(4,5)6)12-16-13-25-21(7,8)26-16/h14-17H,11-13H2,1-10H3/t14-,15?,16+,17-/m1/s1 |
| InChIKey | QKCACGBMCJREOA-KFIMKLJYSA-N |
| XLogP | 4.32 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|