C26H48O6Si — CID 102150066
ethyl 2-[(2R,5S)-5-[(1R,2R,3R)-1-(methoxymethoxy)-3-methyl-2-tri(propan-2-yl)silyloxyhex-5-ynyl]oxolan-2-yl]acetate (PubChem CID 102150066) has the molecular formula C26H48O6Si and a molecular weight of 484.75 g/mol. Its IUPAC name is ethyl 2-[(2R,5S)-5-[(1R,2R,3R)-1-(methoxymethoxy)-3-methyl-2-tri(propan-2-yl)silyloxyhex-5-ynyl]oxolan-2-yl]acetate.
| Compound Name | ethyl 2-[(2R,5S)-5-[(1R,2R,3R)-1-(methoxymethoxy)-3-methyl-2-tri(propan-2-yl)silyloxyhex-5-ynyl]oxolan-2-yl]acetate |
|---|---|
| PubChem CID | 102150066 |
| Molecular Formula | C26H48O6Si |
| Molecular Weight | 484.75 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | ethyl 2-[(2R,5S)-5-[(1R,2R,3R)-1-(methoxymethoxy)-3-methyl-2-tri(propan-2-yl)silyloxyhex-5-ynyl]oxolan-2-yl]acetate |
| SMILES | C#CC[C@@H](C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](OCOC)[C@@H]1CC[C@H](CC(=O)OCC)O1 |
| InChI | InChI=1S/C26H48O6Si/c1-11-13-21(9)25(32-33(18(3)4,19(5)6)20(7)8)26(30-17-28-10)23-15-14-22(31-23)16-24(27)29-12-2/h1,18-23,25-26H,12-17H2,2-10H3/t21-,22-,23+,25-,26-/m1/s1 |
| InChIKey | RGIGYRGIXLXWHR-PNZHNUMHSA-N |
| XLogP | 5.70 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.75 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|