C24H42O7Si — CID 24754940
[(1S,3R,4S,8R,9R,11R)-1-methoxy-11-methyl-6-oxo-3-triethylsilyloxy-5,14-dioxatricyclo[9.2.1.04,8]tetradecan-9-yl] 2-methylpropanoate (PubChem CID 24754940) has the molecular formula C24H42O7Si and a molecular weight of 470.68 g/mol. Its IUPAC name is [(1S,3R,4S,8R,9R,11R)-1-methoxy-11-methyl-6-oxo-3-triethylsilyloxy-5,14-dioxatricyclo[9.2.1.04,8]tetradecan-9-yl] 2-methylpropanoate.
| Compound Name | [(1S,3R,4S,8R,9R,11R)-1-methoxy-11-methyl-6-oxo-3-triethylsilyloxy-5,14-dioxatricyclo[9.2.1.04,8]tetradecan-9-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 24754940 |
| Molecular Formula | C24H42O7Si |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | [(1S,3R,4S,8R,9R,11R)-1-methoxy-11-methyl-6-oxo-3-triethylsilyloxy-5,14-dioxatricyclo[9.2.1.04,8]tetradecan-9-yl] 2-methylpropanoate |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C[C@]2(OC)CC[C@](C)(C[C@@H](OC(=O)C(C)C)[C@H]3CC(=O)O[C@@H]31)O2 |
| InChI | InChI=1S/C24H42O7Si/c1-8-32(9-2,10-3)30-19-15-24(27-7)12-11-23(6,31-24)14-18(28-22(26)16(4)5)17-13-20(25)29-21(17)19/h16-19,21H,8-15H2,1-7H3/t17-,18-,19-,21+,23-,24+/m1/s1 |
| InChIKey | DNAUQQVSOHITSE-UAABRMHFSA-N |
| XLogP | 4.58 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|