C21H38O5Si — CID 10883861
(1S,4R,5R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one (PubChem CID 10883861) has the molecular formula C21H38O5Si and a molecular weight of 398.62 g/mol. Its IUPAC name is (1S,4R,5R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one.
| Compound Name | (1S,4R,5R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one |
|---|---|
| PubChem CID | 10883861 |
| Molecular Formula | C21H38O5Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | (1S,4R,5R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one |
| SMILES | CC1(C)OC[C@H]([C@]23OC(=O)[C@H](CCO[Si](C)(C)C(C)(C)C)[C@H]2CC3(C)C)O1 |
| InChI | InChI=1S/C21H38O5Si/c1-18(2,3)27(8,9)24-11-10-14-15-12-19(4,5)21(15,26-17(14)22)16-13-23-20(6,7)25-16/h14-16H,10-13H2,1-9H3/t14-,15-,16-,21-/m1/s1 |
| InChIKey | KAKILFDMPXLRIV-WSOZGMELSA-N |
| XLogP | 4.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|