C15H24O5 — CID 10891381
(1S,4R,5R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(2-hydroxyethyl)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one (PubChem CID 10891381) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is (1S,4R,5R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(2-hydroxyethyl)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one.
| Compound Name | (1S,4R,5R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(2-hydroxyethyl)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one |
|---|---|
| PubChem CID | 10891381 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (1S,4R,5R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(2-hydroxyethyl)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one |
| SMILES | CC1(C)OC[C@@H]([C@]23OC(=O)[C@H](CCO)[C@H]2CC3(C)C)O1 |
| InChI | InChI=1S/C15H24O5/c1-13(2)7-10-9(5-6-16)12(17)20-15(10,13)11-8-18-14(3,4)19-11/h9-11,16H,5-8H2,1-4H3/t9-,10-,11+,15-/m1/s1 |
| InChIKey | AKJZEULIKBUNMV-YYHMBLRTSA-N |
| XLogP | 1.48 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |