C10H14O5 — CID 135041029
(1S,2S,6S,7R)-7-(hydroxymethyl)-4,4-dimethyl-3,5,8-trioxatricyclo[5.3.0.02,6]decan-9-one (PubChem CID 135041029) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is (1S,2S,6S,7R)-7-(hydroxymethyl)-4,4-dimethyl-3,5,8-trioxatricyclo[5.3.0.02,6]decan-9-one.
| Compound Name | (1S,2S,6S,7R)-7-(hydroxymethyl)-4,4-dimethyl-3,5,8-trioxatricyclo[5.3.0.02,6]decan-9-one |
|---|---|
| PubChem CID | 135041029 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (1S,2S,6S,7R)-7-(hydroxymethyl)-4,4-dimethyl-3,5,8-trioxatricyclo[5.3.0.02,6]decan-9-one |
| SMILES | CC1(C)O[C@H]2[C@@H]3CC(=O)O[C@]3(CO)[C@H]2O1 |
| InChI | InChI=1S/C10H14O5/c1-9(2)14-7-5-3-6(12)13-10(5,4-11)8(7)15-9/h5,7-8,11H,3-4H2,1-2H3/t5-,7-,8-,10-/m0/s1 |
| InChIKey | RPYIWIFCKGBVJC-BNJNZJEJSA-N |
| XLogP | -0.19 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |