C13H16O7 — CID 15293790
[(1R,2S,6R,7R,8S)-4,10-dioxo-3,5,9-trioxatricyclo[5.3.0.02,6]decan-8-yl]methyl 2,2-dimethylpropanoate (PubChem CID 15293790) has the molecular formula C13H16O7 and a molecular weight of 284.26 g/mol. Its IUPAC name is [(1R,2S,6R,7R,8S)-4,10-dioxo-3,5,9-trioxatricyclo[5.3.0.02,6]decan-8-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(1R,2S,6R,7R,8S)-4,10-dioxo-3,5,9-trioxatricyclo[5.3.0.02,6]decan-8-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 15293790 |
| Molecular Formula | C13H16O7 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | [(1R,2S,6R,7R,8S)-4,10-dioxo-3,5,9-trioxatricyclo[5.3.0.02,6]decan-8-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1OC(=O)[C@H]2[C@@H]3OC(=O)O[C@@H]3[C@H]21 |
| InChI | InChI=1S/C13H16O7/c1-13(2,3)11(15)17-4-5-6-7(10(14)18-5)9-8(6)19-12(16)20-9/h5-9H,4H2,1-3H3/t5-,6+,7-,8-,9+/m1/s1 |
| InChIKey | UVPOLVRYZRJNDH-WUNNTHRKSA-N |
| XLogP | 0.65 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|