C14H18O7 — CID 11087810
[(1S,2R,6S,7R,8S)-1-methyl-4,10-dioxo-3,5,9-trioxatricyclo[5.3.0.02,6]decan-8-yl]methyl 2,2-dimethylpropanoate (PubChem CID 11087810) has the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. Its IUPAC name is [(1S,2R,6S,7R,8S)-1-methyl-4,10-dioxo-3,5,9-trioxatricyclo[5.3.0.02,6]decan-8-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(1S,2R,6S,7R,8S)-1-methyl-4,10-dioxo-3,5,9-trioxatricyclo[5.3.0.02,6]decan-8-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11087810 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [(1S,2R,6S,7R,8S)-1-methyl-4,10-dioxo-3,5,9-trioxatricyclo[5.3.0.02,6]decan-8-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1OC(=O)[C@@]2(C)[C@H]1[C@@H]1OC(=O)O[C@@H]12 |
| InChI | InChI=1S/C14H18O7/c1-13(2,3)10(15)18-5-6-7-8-9(21-12(17)20-8)14(7,4)11(16)19-6/h6-9H,5H2,1-4H3/t6-,7-,8+,9+,14+/m1/s1 |
| InChIKey | WIZVMBFQEWZVOP-CRGDGGKYSA-N |
| XLogP | 1.04 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|