C11H16O3 — CID 11229353
(1S,5R,7R)-5,6,6-trimethyl-2,9-dioxatricyclo[5.3.0.01,5]decan-8-one (PubChem CID 11229353) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (1S,5R,7R)-5,6,6-trimethyl-2,9-dioxatricyclo[5.3.0.01,5]decan-8-one.
| Compound Name | (1S,5R,7R)-5,6,6-trimethyl-2,9-dioxatricyclo[5.3.0.01,5]decan-8-one |
|---|---|
| PubChem CID | 11229353 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (1S,5R,7R)-5,6,6-trimethyl-2,9-dioxatricyclo[5.3.0.01,5]decan-8-one |
| SMILES | CC1(C)[C@H]2C(=O)OC[C@]23OCC[C@]13C |
| InChI | InChI=1S/C11H16O3/c1-9(2)7-8(12)13-6-11(7)10(9,3)4-5-14-11/h7H,4-6H2,1-3H3/t7-,10-,11+/m1/s1 |
| InChIKey | LFLXJVKXKOVVDG-ONOSFVFSSA-N |
| XLogP | 1.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |