C4H4O4 — CID 169122492
1,3,5-trioxaspiro[3.3]heptan-2-one (PubChem CID 169122492) has the molecular formula C4H4O4 and a molecular weight of 116.07 g/mol. Its IUPAC name is 1,3,5-trioxaspiro[3.3]heptan-2-one.
| Compound Name | 1,3,5-trioxaspiro[3.3]heptan-2-one |
|---|---|
| PubChem CID | 169122492 |
| Molecular Formula | C4H4O4 |
| Molecular Weight | 116.07 g/mol |
| Exact Mass | 116.01 |
| IUPAC Name | 1,3,5-trioxaspiro[3.3]heptan-2-one |
| SMILES | O=C1OC2(CCO2)O1 |
| InChI | InChI=1S/C4H4O4/c5-3-7-4(8-3)1-2-6-4/h1-2H2 |
| InChIKey | BHWIPIMWTGGFTC-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.07 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |