C7H4Cl2O4 — CID 101159985
(1R,2R,6R,7S)-2,6-dichloro-3,5,10-trioxatricyclo[5.2.1.02,6]dec-8-en-4-one (PubChem CID 101159985) has the molecular formula C7H4Cl2O4 and a molecular weight of 223.01 g/mol. Its IUPAC name is (1R,2R,6R,7S)-2,6-dichloro-3,5,10-trioxatricyclo[5.2.1.02,6]dec-8-en-4-one.
| Compound Name | (1R,2R,6R,7S)-2,6-dichloro-3,5,10-trioxatricyclo[5.2.1.02,6]dec-8-en-4-one |
|---|---|
| PubChem CID | 101159985 |
| Molecular Formula | C7H4Cl2O4 |
| Molecular Weight | 223.01 g/mol |
| Exact Mass | 221.95 |
| IUPAC Name | (1R,2R,6R,7S)-2,6-dichloro-3,5,10-trioxatricyclo[5.2.1.02,6]dec-8-en-4-one |
| SMILES | O=C1O[C@@]2(Cl)[C@@H]3C=C[C@@H](O3)[C@]2(Cl)O1 |
| InChI | InChI=1S/C7H4Cl2O4/c8-6-3-1-2-4(11-3)7(6,9)13-5(10)12-6/h1-4H/t3-,4+,6-,7-/m0/s1 |
| InChIKey | KEHUGHLLHWOURT-FXZMZVCPSA-N |
| XLogP | 1.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.01 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|