C20H18O8S2 — CID 159702936
8,13-dioxa-11-thiatetracyclo[4.3.3.12,5.01,6]tridecane-7,9-dione;8,13-dioxa-11-thiatetracyclo[4.3.3.12,5.01,6]tridec-3-ene-7,9-dione (PubChem CID 159702936) has the molecular formula C20H18O8S2 and a molecular weight of 450.49 g/mol. Its IUPAC name is 8,13-dioxa-11-thiatetracyclo[4.3.3.12,5.01,6]tridecane-7,9-dione;8,13-dioxa-11-thiatetracyclo[4.3.3.12,5.01,6]tridec-3-ene-7,9-dione.
| Compound Name | 8,13-dioxa-11-thiatetracyclo[4.3.3.12,5.01,6]tridecane-7,9-dione;8,13-dioxa-11-thiatetracyclo[4.3.3.12,5.01,6]tridec-3-ene-7,9-dione |
|---|---|
| PubChem CID | 159702936 |
| Molecular Formula | C20H18O8S2 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | 8,13-dioxa-11-thiatetracyclo[4.3.3.12,5.01,6]tridecane-7,9-dione;8,13-dioxa-11-thiatetracyclo[4.3.3.12,5.01,6]tridec-3-ene-7,9-dione |
| SMILES | O=C1OC(=O)C23CSCC12C1C=CC3O1.O=C1OC(=O)C23CSCC12C1CCC3O1 |
| InChI | InChI=1S/C10H10O4S.C10H8O4S/c2*11-7-9-3-15-4-10(9,8(12)14-7)6-2-1-5(9)13-6/h5-6H,1-4H2;1-2,5-6H,3-4H2 |
| InChIKey | MXVWUNCOLOZGNG-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|