C10H10NO5- — CID 163840762
11-oxido-8,13-dioxa-11-azatetracyclo[4.3.3.12,5.01,6]tridecane-7,9-dione (PubChem CID 163840762) has the molecular formula C10H10NO5- and a molecular weight of 224.19 g/mol. Its IUPAC name is 11-oxido-8,13-dioxa-11-azatetracyclo[4.3.3.12,5.01,6]tridecane-7,9-dione.
| Compound Name | 11-oxido-8,13-dioxa-11-azatetracyclo[4.3.3.12,5.01,6]tridecane-7,9-dione |
|---|---|
| PubChem CID | 163840762 |
| Molecular Formula | C10H10NO5- |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 11-oxido-8,13-dioxa-11-azatetracyclo[4.3.3.12,5.01,6]tridecane-7,9-dione |
| SMILES | O=C1OC(=O)C23CN([O-])CC12C1CCC3O1 |
| InChI | InChI=1S/C10H10NO5/c12-7-9-3-11(14)4-10(9,8(13)16-7)6-2-1-5(9)15-6/h5-6H,1-4H2/q-1 |
| InChIKey | LYLXDWPYKVMPJC-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|