C23H30N2O6 — CID 102145861
(3aS,4R,7S,7aR)-2-[3-[(3aS,4R,7S,7aR)-3a,7a-dimethyl-1,3-dioxo-4,5,6,7-tetrahydro-4,7-epoxyisoindol-2-yl]propyl]-3a,7a-dimethyl-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 102145861) has the molecular formula C23H30N2O6 and a molecular weight of 430.50 g/mol. Its IUPAC name is (3aS,4R,7S,7aR)-2-[3-[(3aS,4R,7S,7aR)-3a,7a-dimethyl-1,3-dioxo-4,5,6,7-tetrahydro-4,7-epoxyisoindol-2-yl]propyl]-3a,7a-dimethyl-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,4R,7S,7aR)-2-[3-[(3aS,4R,7S,7aR)-3a,7a-dimethyl-1,3-dioxo-4,5,6,7-tetrahydro-4,7-epoxyisoindol-2-yl]propyl]-3a,7a-dimethyl-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 102145861 |
| Molecular Formula | C23H30N2O6 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (3aS,4R,7S,7aR)-2-[3-[(3aS,4R,7S,7aR)-3a,7a-dimethyl-1,3-dioxo-4,5,6,7-tetrahydro-4,7-epoxyisoindol-2-yl]propyl]-3a,7a-dimethyl-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | C[C@@]12C(=O)N(CCCN3C(=O)[C@@]4(C)[C@@H]5CC[C@@H](O5)[C@@]4(C)C3=O)C(=O)[C@]1(C)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C23H30N2O6/c1-20-12-6-7-13(30-12)21(20,2)17(27)24(16(20)26)10-5-11-25-18(28)22(3)14-8-9-15(31-14)23(22,4)19(25)29/h12-15H,5-11H2,1-4H3/t12-,13+,14-,15+,20+,21-,22+,23- |
| InChIKey | QAJLNPRUKGVGJK-WJDUAKQISA-N |
| XLogP | 1.26 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|