C20H26O9 — CID 86676020
(1R,2S,6R,7S)-2,6-dimethyl-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione;2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid (PubChem CID 86676020) has the molecular formula C20H26O9 and a molecular weight of 410.42 g/mol. Its IUPAC name is (1R,2S,6R,7S)-2,6-dimethyl-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione;2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid.
| Compound Name | (1R,2S,6R,7S)-2,6-dimethyl-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione;2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 86676020 |
| Molecular Formula | C20H26O9 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | (1R,2S,6R,7S)-2,6-dimethyl-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione;2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| SMILES | CC1(C(=O)O)C2CCC(O2)C1(C)C(=O)O.C[C@@]12C(=O)OC(=O)[C@]1(C)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C10H14O5.C10H12O4/c1-9(7(11)12)5-3-4-6(15-5)10(9,2)8(13)14;1-9-5-3-4-6(13-5)10(9,2)8(12)14-7(9)11/h5-6H,3-4H2,1-2H3,(H,11,12)(H,13,14);5-6H,3-4H2,1-2H3/t;5-,6+,9+,10- |
| InChIKey | VYQQEQBNIXINLS-KFJLSGOXSA-N |
| XLogP | 1.37 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|