C8H8O4 — CID 174808889
spiro[7-oxabicyclo[2.2.1]heptane-2,3'-oxetane]-2',4'-dione (PubChem CID 174808889) has the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. Its IUPAC name is spiro[7-oxabicyclo[2.2.1]heptane-2,3'-oxetane]-2',4'-dione.
| Compound Name | spiro[7-oxabicyclo[2.2.1]heptane-2,3'-oxetane]-2',4'-dione |
|---|---|
| PubChem CID | 174808889 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | spiro[7-oxabicyclo[2.2.1]heptane-2,3'-oxetane]-2',4'-dione |
| SMILES | O=C1OC(=O)C12CC1CCC2O1 |
| InChI | InChI=1S/C8H8O4/c9-6-8(7(10)12-6)3-4-1-2-5(8)11-4/h4-5H,1-3H2 |
| InChIKey | YEWWZLAFQALEDO-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|