C8H8Cl2O2 — CID 11608152
(1R,2S,4R,5S)-2,4-dichloro-2-methyl-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 11608152) has the molecular formula C8H8Cl2O2 and a molecular weight of 207.06 g/mol. Its IUPAC name is (1R,2S,4R,5S)-2,4-dichloro-2-methyl-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,2S,4R,5S)-2,4-dichloro-2-methyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 11608152 |
| Molecular Formula | C8H8Cl2O2 |
| Molecular Weight | 207.06 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | (1R,2S,4R,5S)-2,4-dichloro-2-methyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | C[C@@]1(Cl)C(=O)[C@H](Cl)[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C8H8Cl2O2/c1-8(10)5-3-2-4(12-5)6(9)7(8)11/h2-6H,1H3/t4-,5+,6+,8-/m0/s1 |
| InChIKey | FPUMNLQCBHIFQU-FJDLHZNMSA-N |
| XLogP | 1.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.06 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|