C10H11BrO2 — CID 100930524
1-bromo-11-oxatricyclo[4.3.1.12,5]undec-3-en-10-one (PubChem CID 100930524) has the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. Its IUPAC name is 1-bromo-11-oxatricyclo[4.3.1.12,5]undec-3-en-10-one.
| Compound Name | 1-bromo-11-oxatricyclo[4.3.1.12,5]undec-3-en-10-one |
|---|---|
| PubChem CID | 100930524 |
| Molecular Formula | C10H11BrO2 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 1-bromo-11-oxatricyclo[4.3.1.12,5]undec-3-en-10-one |
| SMILES | O=C1C2CCCC1(Br)C1C=CC2O1 |
| InChI | InChI=1S/C10H11BrO2/c11-10-5-1-2-6(9(10)12)7-3-4-8(10)13-7/h3-4,6-8H,1-2,5H2 |
| InChIKey | CTBUZOFHELDQIJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|