C13H11Br2NO4 — CID 139055732
(1R,2S,3R,6S,7R,8S,9S,13R)-9,13-dibromo-11-methyl-14,15-dioxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione (PubChem CID 139055732) has the molecular formula C13H11Br2NO4 and a molecular weight of 405.04 g/mol. Its IUPAC name is (1R,2S,3R,6S,7R,8S,9S,13R)-9,13-dibromo-11-methyl-14,15-dioxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione.
| Compound Name | (1R,2S,3R,6S,7R,8S,9S,13R)-9,13-dibromo-11-methyl-14,15-dioxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione |
|---|---|
| PubChem CID | 139055732 |
| Molecular Formula | C13H11Br2NO4 |
| Molecular Weight | 405.04 g/mol |
| Exact Mass | 402.91 |
| IUPAC Name | (1R,2S,3R,6S,7R,8S,9S,13R)-9,13-dibromo-11-methyl-14,15-dioxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione |
| SMILES | CN1C(=O)[C@@]2(Br)[C@H]3O[C@H]([C@H]4[C@@H]3[C@@H]3C=C[C@H]4O3)[C@@]2(Br)C1=O |
| InChI | InChI=1S/C13H11Br2NO4/c1-16-10(17)12(14)8-6-4-2-3-5(19-4)7(6)9(20-8)13(12,15)11(16)18/h2-9H,1H3/t4-,5+,6-,7+,8-,9+,12-,13+ |
| InChIKey | TZYNVMJSXLUSHR-SLHXXETISA-N |
| XLogP | 0.60 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.04 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|