C10H13NO3 — CID 163581282
3-methoxy-2-methyl-3a,4,7,7a-tetrahydro-3H-4,7-epoxyisoindol-1-one (PubChem CID 163581282) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-methoxy-2-methyl-3a,4,7,7a-tetrahydro-3H-4,7-epoxyisoindol-1-one.
| Compound Name | 3-methoxy-2-methyl-3a,4,7,7a-tetrahydro-3H-4,7-epoxyisoindol-1-one |
|---|---|
| PubChem CID | 163581282 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 3-methoxy-2-methyl-3a,4,7,7a-tetrahydro-3H-4,7-epoxyisoindol-1-one |
| SMILES | COC1C2C3C=CC(O3)C2C(=O)N1C |
| InChI | InChI=1S/C10H13NO3/c1-11-9(12)7-5-3-4-6(14-5)8(7)10(11)13-2/h3-8,10H,1-2H3 |
| InChIKey | GHSXLWAYBUEKAP-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|