C9H11NO4 — CID 130282894
3-hydroxy-2-methoxy-3a,4,7,7a-tetrahydro-3H-4,7-epoxyisoindol-1-one (PubChem CID 130282894) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 3-hydroxy-2-methoxy-3a,4,7,7a-tetrahydro-3H-4,7-epoxyisoindol-1-one.
| Compound Name | 3-hydroxy-2-methoxy-3a,4,7,7a-tetrahydro-3H-4,7-epoxyisoindol-1-one |
|---|---|
| PubChem CID | 130282894 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 3-hydroxy-2-methoxy-3a,4,7,7a-tetrahydro-3H-4,7-epoxyisoindol-1-one |
| SMILES | CON1C(=O)C2C3C=CC(O3)C2C1O |
| InChI | InChI=1S/C9H11NO4/c1-13-10-8(11)6-4-2-3-5(14-4)7(6)9(10)12/h2-8,11H,1H3 |
| InChIKey | SSUOSDYFSPKQAJ-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|