C17H15NO5 — CID 98068660
ethyl 4-[(3aR,4S,7S,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]benzoate (PubChem CID 98068660) has the molecular formula C17H15NO5 and a molecular weight of 313.31 g/mol. Its IUPAC name is ethyl 4-[(3aR,4S,7S,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]benzoate.
| Compound Name | ethyl 4-[(3aR,4S,7S,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 98068660 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | ethyl 4-[(3aR,4S,7S,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@@H]3[C@@H](C2=O)[C@@H]2C=C[C@@H]3O2)cc1 |
| InChI | InChI=1S/C17H15NO5/c1-2-22-17(21)9-3-5-10(6-4-9)18-15(19)13-11-7-8-12(23-11)14(13)16(18)20/h3-8,11-14H,2H2,1H3/t11-,12-,13-,14-/m0/s1 |
| InChIKey | QBAAYTJNDVIWIZ-XUXIUFHCSA-N |
| XLogP | 1.31 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|