C17H27NO6Si — CID 102027026
2-(3-triethoxysilylpropyl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 102027026) has the molecular formula C17H27NO6Si and a molecular weight of 369.49 g/mol. Its IUPAC name is 2-(3-triethoxysilylpropyl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | 2-(3-triethoxysilylpropyl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 102027026 |
| Molecular Formula | C17H27NO6Si |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2-(3-triethoxysilylpropyl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | CCO[Si](CCCN1C(=O)C2C3C=CC(O3)C2C1=O)(OCC)OCC |
| InChI | InChI=1S/C17H27NO6Si/c1-4-21-25(22-5-2,23-6-3)11-7-10-18-16(19)14-12-8-9-13(24-12)15(14)17(18)20/h8-9,12-15H,4-7,10-11H2,1-3H3 |
| InChIKey | OQROJGUKNGFZAQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|