C7H6Br2O2 — CID 129384175
(1R,2R,4R,5R)-2,4-dibromo-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 129384175) has the molecular formula C7H6Br2O2 and a molecular weight of 281.93 g/mol. Its IUPAC name is (1R,2R,4R,5R)-2,4-dibromo-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,2R,4R,5R)-2,4-dibromo-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 129384175 |
| Molecular Formula | C7H6Br2O2 |
| Molecular Weight | 281.93 g/mol |
| Exact Mass | 279.87 |
| IUPAC Name | (1R,2R,4R,5R)-2,4-dibromo-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | O=C1[C@H](Br)[C@H]2C=C[C@@H](O2)[C@H]1Br |
| InChI | InChI=1S/C7H6Br2O2/c8-5-3-1-2-4(11-3)6(9)7(5)10/h1-6H/t3-,4-,5-,6-/m1/s1 |
| InChIKey | IMTJPLVCOUSVFX-KVTDHHQDSA-N |
| XLogP | 1.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.93 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|