C10H10O3 — CID 23255402
(1S,2R,3R,5R,7S,8R)-3-methyl-4,11-dioxatetracyclo[6.2.1.02,7.03,5]undec-9-en-6-one (PubChem CID 23255402) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is (1S,2R,3R,5R,7S,8R)-3-methyl-4,11-dioxatetracyclo[6.2.1.02,7.03,5]undec-9-en-6-one.
| Compound Name | (1S,2R,3R,5R,7S,8R)-3-methyl-4,11-dioxatetracyclo[6.2.1.02,7.03,5]undec-9-en-6-one |
|---|---|
| PubChem CID | 23255402 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | (1S,2R,3R,5R,7S,8R)-3-methyl-4,11-dioxatetracyclo[6.2.1.02,7.03,5]undec-9-en-6-one |
| SMILES | C[C@]12O[C@H]1C(=O)[C@H]1[C@@H]2[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C10H10O3/c1-10-7-5-3-2-4(12-5)6(7)8(11)9(10)13-10/h2-7,9H,1H3/t4-,5+,6-,7+,9+,10-/m1/s1 |
| InChIKey | ZYQZVLIQWSKUKT-LLXVQXCASA-N |
| XLogP | 0.30 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|