C10H14O2 — CID 10920879
(1S,6R)-2,7,7-trimethyl-3-oxatricyclo[4.1.1.02,4]octan-5-one (PubChem CID 10920879) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (1S,6R)-2,7,7-trimethyl-3-oxatricyclo[4.1.1.02,4]octan-5-one.
| Compound Name | (1S,6R)-2,7,7-trimethyl-3-oxatricyclo[4.1.1.02,4]octan-5-one |
|---|---|
| PubChem CID | 10920879 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (1S,6R)-2,7,7-trimethyl-3-oxatricyclo[4.1.1.02,4]octan-5-one |
| SMILES | CC12OC1C(=O)[C@@H]1C[C@H]2C1(C)C |
| InChI | InChI=1S/C10H14O2/c1-9(2)5-4-6(9)10(3)8(12-10)7(5)11/h5-6,8H,4H2,1-3H3/t5-,6-,8?,10?/m0/s1 |
| InChIKey | FAZVMCOEZIXWMK-KCGXGXEVSA-N |
| XLogP | 1.39 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|