C15H24O4 — CID 162902476
(1aR,2aR,4S,6aS,7S,7aR)-4-hydroxy-7-(hydroxymethyl)-3,3,6a,7a-tetramethyl-1a,2a,4,5,6,7-hexahydronaphtho[2,3-b]oxiren-2-one (PubChem CID 162902476) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (1aR,2aR,4S,6aS,7S,7aR)-4-hydroxy-7-(hydroxymethyl)-3,3,6a,7a-tetramethyl-1a,2a,4,5,6,7-hexahydronaphtho[2,3-b]oxiren-2-one.
| Compound Name | (1aR,2aR,4S,6aS,7S,7aR)-4-hydroxy-7-(hydroxymethyl)-3,3,6a,7a-tetramethyl-1a,2a,4,5,6,7-hexahydronaphtho[2,3-b]oxiren-2-one |
|---|---|
| PubChem CID | 162902476 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (1aR,2aR,4S,6aS,7S,7aR)-4-hydroxy-7-(hydroxymethyl)-3,3,6a,7a-tetramethyl-1a,2a,4,5,6,7-hexahydronaphtho[2,3-b]oxiren-2-one |
| SMILES | CC1(C)[C@@H](O)CC[C@@]2(C)[C@@H](CO)[C@@]3(C)O[C@H]3C(=O)[C@@H]12 |
| InChI | InChI=1S/C15H24O4/c1-13(2)9(17)5-6-14(3)8(7-16)15(4)12(19-15)10(18)11(13)14/h8-9,11-12,16-17H,5-7H2,1-4H3/t8-,9+,11+,12+,14+,15-/m1/s1 |
| InChIKey | YPCORLCLAAQRFS-ORRDOLAHSA-N |
| XLogP | 1.14 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|