C16H30O3 — CID 162816441
5,6-bis(hydroxymethyl)-1,1,4a,6-tetramethyl-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol (PubChem CID 162816441) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is 5,6-bis(hydroxymethyl)-1,1,4a,6-tetramethyl-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol.
| Compound Name | 5,6-bis(hydroxymethyl)-1,1,4a,6-tetramethyl-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol |
|---|---|
| PubChem CID | 162816441 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 5,6-bis(hydroxymethyl)-1,1,4a,6-tetramethyl-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol |
| SMILES | CC1(CO)CCC2C(C)(C)C(O)CCC2(C)C1CO |
| InChI | InChI=1S/C16H30O3/c1-14(2)11-5-7-15(3,10-18)12(9-17)16(11,4)8-6-13(14)19/h11-13,17-19H,5-10H2,1-4H3 |
| InChIKey | PUJQDHXZYPEITD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |