C15H28O3 — CID 78072368
1,5-bis(hydroxymethyl)-2,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol (PubChem CID 78072368) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is 1,5-bis(hydroxymethyl)-2,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol.
| Compound Name | 1,5-bis(hydroxymethyl)-2,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 78072368 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 1,5-bis(hydroxymethyl)-2,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
| SMILES | CC1(O)CCC2C(C)(CO)CCCC2(C)C1CO |
| InChI | InChI=1S/C15H28O3/c1-13(10-17)6-4-7-14(2)11(13)5-8-15(3,18)12(14)9-16/h11-12,16-18H,4-10H2,1-3H3 |
| InChIKey | PMQQBZKKHRQDBH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |