C21H38O — CID 163805521
[(4bR)-8a-ethyl-1,4a,7,7-tetramethyl-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthren-1-yl]methanol (PubChem CID 163805521) has the molecular formula C21H38O and a molecular weight of 306.53 g/mol. Its IUPAC name is [(4bR)-8a-ethyl-1,4a,7,7-tetramethyl-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthren-1-yl]methanol.
| Compound Name | [(4bR)-8a-ethyl-1,4a,7,7-tetramethyl-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthren-1-yl]methanol |
|---|---|
| PubChem CID | 163805521 |
| Molecular Formula | C21H38O |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.29 |
| IUPAC Name | [(4bR)-8a-ethyl-1,4a,7,7-tetramethyl-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthren-1-yl]methanol |
| SMILES | CCC12CCC3C(C)(CO)CCCC3(C)[C@@H]1CCC(C)(C)C2 |
| InChI | InChI=1S/C21H38O/c1-6-21-13-9-16-19(4,15-22)10-7-11-20(16,5)17(21)8-12-18(2,3)14-21/h16-17,22H,6-15H2,1-5H3/t16?,17-,19?,20?,21?/m0/s1 |
| InChIKey | NIRUMVDJLRSZRI-VTOWBOPJSA-N |
| XLogP | 5.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |