C23H38O2 — CID 139080593
[(1S,4R,5R,9R,10R,12R,14R)-5-(hydroxymethyl)-5,9-dimethyl-16-propan-2-yl-14-tetracyclo[10.2.2.01,10.04,9]hexadec-15-enyl]methanol (PubChem CID 139080593) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is [(1S,4R,5R,9R,10R,12R,14R)-5-(hydroxymethyl)-5,9-dimethyl-16-propan-2-yl-14-tetracyclo[10.2.2.01,10.04,9]hexadec-15-enyl]methanol.
| Compound Name | [(1S,4R,5R,9R,10R,12R,14R)-5-(hydroxymethyl)-5,9-dimethyl-16-propan-2-yl-14-tetracyclo[10.2.2.01,10.04,9]hexadec-15-enyl]methanol |
|---|---|
| PubChem CID | 139080593 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | [(1S,4R,5R,9R,10R,12R,14R)-5-(hydroxymethyl)-5,9-dimethyl-16-propan-2-yl-14-tetracyclo[10.2.2.01,10.04,9]hexadec-15-enyl]methanol |
| SMILES | CC(C)C1=C[C@@]23CC[C@H]4[C@](C)(CO)CCC[C@]4(C)[C@H]2C[C@@H]1C[C@H]3CO |
| InChI | InChI=1S/C23H38O2/c1-15(2)18-12-23-9-6-19-21(3,14-25)7-5-8-22(19,4)20(23)11-16(18)10-17(23)13-24/h12,15-17,19-20,24-25H,5-11,13-14H2,1-4H3/t16-,17-,19-,20+,21-,22-,23+/m0/s1 |
| InChIKey | GOUJGTSQNGMQHJ-KFZNPZRXSA-N |
| XLogP | 4.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|